C7H14N4 — CID 58841086
2-(azidomethyl)-1,3-dimethylpyrrolidine (PubChem CID 58841086) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 2-(azidomethyl)-1,3-dimethylpyrrolidine.
| Compound Name | 2-(azidomethyl)-1,3-dimethylpyrrolidine |
|---|---|
| PubChem CID | 58841086 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 2-(azidomethyl)-1,3-dimethylpyrrolidine |
| SMILES | CC1CCN(C)C1CN=[N+]=[N-] |
| InChI | InChI=1S/C7H14N4/c1-6-3-4-11(2)7(6)5-9-10-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | TWVMLQQBBCWFEA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|