C10H17N3 — CID 145406355
4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane (PubChem CID 145406355) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane.
| Compound Name | 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 145406355 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane |
| SMILES | C1=CCC(n2cnnc2)CC1.CC |
| InChI | InChI=1S/C8H11N3.C2H6/c1-2-4-8(5-3-1)11-6-9-10-7-11;1-2/h1-2,6-8H,3-5H2;1-2H3 |
| InChIKey | GOTFIFWOIQWORJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|