About 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane
4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane (PubChem CID 145406355) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane.
Molecular Properties
| Compound Name | 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane |
| PubChem CID | 145406355 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane |
| SMILES | C1=CCC(n2cnnc2)CC1.CC |
| InChI | InChI=1S/C8H11N3.C2H6/c1-2-4-8(5-3-1)11-6-9-10-7-11;1-2/h1-2,6-8H,3-5H2;1-2H3 |
| InChIKey | GOTFIFWOIQWORJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane?
The IUPAC name of 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane (CID 145406355) is 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane.
What is the SMILES notation for 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane?
The canonical SMILES for 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane is C1=CCC(n2cnnc2)CC1.CC.
What is the InChIKey of 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane?
The InChIKey is GOTFIFWOIQWORJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3.C2H6/c1-2-4-8(5-3-1)11-6-9-10-7-11;1-2/h1-2,6-8H,3-5H2;1-2H3.
What are the key properties of 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane?
4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane has a molecular weight of 179.27 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohex-3-en-1-yl-1,2,4-triazole;ethane is sourced from PubChem (CID 145406355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).