C8H11N3O — CID 68879711
4-(1,2,4-triazol-4-yl)cyclohexan-1-one (PubChem CID 68879711) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 4-(1,2,4-triazol-4-yl)cyclohexan-1-one.
| Compound Name | 4-(1,2,4-triazol-4-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 68879711 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 4-(1,2,4-triazol-4-yl)cyclohexan-1-one |
| SMILES | O=C1CCC(n2cnnc2)CC1 |
| InChI | InChI=1S/C8H11N3O/c12-8-3-1-7(2-4-8)11-5-9-10-6-11/h5-7H,1-4H2 |
| InChIKey | LZDFBGOYELGYHS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |