C14H24N4 — CID 170216225
N-cyclohexyl-4-(1,2,4-triazol-4-yl)cyclohexan-1-amine (PubChem CID 170216225) has the molecular formula C14H24N4 and a molecular weight of 248.37 g/mol. Its IUPAC name is N-cyclohexyl-4-(1,2,4-triazol-4-yl)cyclohexan-1-amine.
| Compound Name | N-cyclohexyl-4-(1,2,4-triazol-4-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 170216225 |
| Molecular Formula | C14H24N4 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | N-cyclohexyl-4-(1,2,4-triazol-4-yl)cyclohexan-1-amine |
| SMILES | c1nncn1C1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C14H24N4/c1-2-4-12(5-3-1)17-13-6-8-14(9-7-13)18-10-15-16-11-18/h10-14,17H,1-9H2 |
| InChIKey | NSSNBRYJMKWDGJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |