C12H16N4S — CID 79296840
6-cyclohex-3-en-1-yl-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 79296840) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 6-cyclohex-3-en-1-yl-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 6-cyclohex-3-en-1-yl-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 79296840 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 6-cyclohex-3-en-1-yl-1,3-dimethyl-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2C1CC=CCC1 |
| InChI | InChI=1S/C12H16N4S/c1-8-10-11(15(2)14-8)16(12(17)13-10)9-6-4-3-5-7-9/h3-4,9H,5-7H2,1-2H3,(H,13,17) |
| InChIKey | KGRXJANEGGQYPQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|