C11H16N4OS — CID 82727982
1,3-dimethyl-6-(2-methyloxolan-3-yl)-4H-imidazo[4,5-d]pyrazole-5-thione (PubChem CID 82727982) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2-methyloxolan-3-yl)-4H-imidazo[4,5-d]pyrazole-5-thione.
| Compound Name | 1,3-dimethyl-6-(2-methyloxolan-3-yl)-4H-imidazo[4,5-d]pyrazole-5-thione |
|---|---|
| PubChem CID | 82727982 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1,3-dimethyl-6-(2-methyloxolan-3-yl)-4H-imidazo[4,5-d]pyrazole-5-thione |
| SMILES | Cc1nn(C)c2c1[nH]c(=S)n2C1CCOC1C |
| InChI | InChI=1S/C11H16N4OS/c1-6-9-10(14(3)13-6)15(11(17)12-9)8-4-5-16-7(8)2/h7-8H,4-5H2,1-3H3,(H,12,17) |
| InChIKey | MFMLSDWSHMPKFD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|