C18H23NO2 — CID 143824375
5-cyclohexa-1,5-dien-1-yl-2-(2-pyridin-2-ylethyl)pentanoic acid (PubChem CID 143824375) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 5-cyclohexa-1,5-dien-1-yl-2-(2-pyridin-2-ylethyl)pentanoic acid.
| Compound Name | 5-cyclohexa-1,5-dien-1-yl-2-(2-pyridin-2-ylethyl)pentanoic acid |
|---|---|
| PubChem CID | 143824375 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 5-cyclohexa-1,5-dien-1-yl-2-(2-pyridin-2-ylethyl)pentanoic acid |
| SMILES | O=C(O)C(CCCC1=CCCC=C1)CCc1ccccn1 |
| InChI | InChI=1S/C18H23NO2/c20-18(21)16(12-13-17-11-4-5-14-19-17)10-6-9-15-7-2-1-3-8-15/h2,4-5,7-8,11,14,16H,1,3,6,9-10,12-13H2,(H,20,21) |
| InChIKey | ZENJTQMMJLUDAH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |