C23H33P — CID 142870081
[(1Z,3Z,7E)-11-cyclohexa-1,5-dien-1-yl-4-ethenyl-7-ethylidene-8-methyl-5-methylideneundeca-1,3-dienyl]phosphane (PubChem CID 142870081) has the molecular formula C23H33P and a molecular weight of 340.49 g/mol. Its IUPAC name is [(1Z,3Z,7E)-11-cyclohexa-1,5-dien-1-yl-4-ethenyl-7-ethylidene-8-methyl-5-methylideneundeca-1,3-dienyl]phosphane.
| Compound Name | [(1Z,3Z,7E)-11-cyclohexa-1,5-dien-1-yl-4-ethenyl-7-ethylidene-8-methyl-5-methylideneundeca-1,3-dienyl]phosphane |
|---|---|
| PubChem CID | 142870081 |
| Molecular Formula | C23H33P |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | [(1Z,3Z,7E)-11-cyclohexa-1,5-dien-1-yl-4-ethenyl-7-ethylidene-8-methyl-5-methylideneundeca-1,3-dienyl]phosphane |
| SMILES | C=C/C(=C/C=C\P)C(=C)C/C(=C\C)C(C)CCCC1=CCCC=C1 |
| InChI | InChI=1S/C23H33P/c1-5-22(16-11-17-24)20(4)18-23(6-2)19(3)12-10-15-21-13-8-7-9-14-21/h5-6,8,11,13-14,16-17,19H,1,4,7,9-10,12,15,18,24H2,2-3H3/b17-11-,22-16-,23-6+ |
| InChIKey | BPVDMKLYXDNOOA-WELQEYSLSA-N |
| XLogP | 7.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|