C11H19NO — CID 143109891
4-cyclohexa-1,5-dien-1-yl-3-methoxybutan-1-amine (PubChem CID 143109891) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-3-methoxybutan-1-amine.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-3-methoxybutan-1-amine |
|---|---|
| PubChem CID | 143109891 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-3-methoxybutan-1-amine |
| SMILES | COC(CCN)CC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c1-13-11(7-8-12)9-10-5-3-2-4-6-10/h3,5-6,11H,2,4,7-9,12H2,1H3 |
| InChIKey | VVDOFKOTFXCPHJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |