C13H23NO2 — CID 143394199
3-cyclohexa-1,5-dien-1-yl-1,1-diethoxypropan-2-amine (PubChem CID 143394199) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-1,1-diethoxypropan-2-amine.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-1,1-diethoxypropan-2-amine |
|---|---|
| PubChem CID | 143394199 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-1,1-diethoxypropan-2-amine |
| SMILES | CCOC(OCC)C(N)CC1=CCCC=C1 |
| InChI | InChI=1S/C13H23NO2/c1-3-15-13(16-4-2)12(14)10-11-8-6-5-7-9-11/h6,8-9,12-13H,3-5,7,10,14H2,1-2H3 |
| InChIKey | MGTSJPGZHNRTGD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|