C19H29NO2 — CID 178167981
N-(1-cyclohexa-1,5-dien-1-yl-4-methyl-3-oxopentan-2-yl)-N-(2-methylpropyl)prop-2-enamide (PubChem CID 178167981) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(1-cyclohexa-1,5-dien-1-yl-4-methyl-3-oxopentan-2-yl)-N-(2-methylpropyl)prop-2-enamide.
| Compound Name | N-(1-cyclohexa-1,5-dien-1-yl-4-methyl-3-oxopentan-2-yl)-N-(2-methylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 178167981 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-(1-cyclohexa-1,5-dien-1-yl-4-methyl-3-oxopentan-2-yl)-N-(2-methylpropyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CC(C)C)C(CC1=CCCC=C1)C(=O)C(C)C |
| InChI | InChI=1S/C19H29NO2/c1-6-18(21)20(13-14(2)3)17(19(22)15(4)5)12-16-10-8-7-9-11-16/h6,8,10-11,14-15,17H,1,7,9,12-13H2,2-5H3 |
| InChIKey | LGJWLRJNYWPXBX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|