C16H21N — CID 143639409
4-[(3E)-3-ethenyl-4-methylhepta-3,6-dienyl]aniline (PubChem CID 143639409) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is 4-[(3E)-3-ethenyl-4-methylhepta-3,6-dienyl]aniline.
| Compound Name | 4-[(3E)-3-ethenyl-4-methylhepta-3,6-dienyl]aniline |
|---|---|
| PubChem CID | 143639409 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 4-[(3E)-3-ethenyl-4-methylhepta-3,6-dienyl]aniline |
| SMILES | C=CC/C(C)=C(/C=C)CCc1ccc(N)cc1 |
| InChI | InChI=1S/C16H21N/c1-4-6-13(3)15(5-2)10-7-14-8-11-16(17)12-9-14/h4-5,8-9,11-12H,1-2,6-7,10,17H2,3H3/b15-13- |
| InChIKey | KPNVVQACPIZAQB-SQFISAMPSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|