C21H36N2O2 — CID 142201217
(2Z,3Z)-2-[4-(4-aminophenyl)butan-2-ylidene]hexa-3,5-dienoic acid;ethane;methanamine (PubChem CID 142201217) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is (2Z,3Z)-2-[4-(4-aminophenyl)butan-2-ylidene]hexa-3,5-dienoic acid;ethane;methanamine.
| Compound Name | (2Z,3Z)-2-[4-(4-aminophenyl)butan-2-ylidene]hexa-3,5-dienoic acid;ethane;methanamine |
|---|---|
| PubChem CID | 142201217 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | (2Z,3Z)-2-[4-(4-aminophenyl)butan-2-ylidene]hexa-3,5-dienoic acid;ethane;methanamine |
| SMILES | C=C/C=C\C(C(=O)O)=C(/C)CCc1ccc(N)cc1.CC.CC.CN |
| InChI | InChI=1S/C16H19NO2.2C2H6.CH5N/c1-3-4-5-15(16(18)19)12(2)6-7-13-8-10-14(17)11-9-13;3*1-2/h3-5,8-11H,1,6-7,17H2,2H3,(H,18,19);2*1-2H3;2H2,1H3/b5-4-,15-12-;;; |
| InChIKey | QYKSBXVWQRVVHI-YBZAQZKQSA-N |
| XLogP | 4.97 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|