C27H29F3O2 — CID 143908814
2,3-difluoro-1-[4-[(3E)-4-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-4-(4-methylcyclohexyl)benzene (PubChem CID 143908814) has the molecular formula C27H29F3O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[(3E)-4-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-4-(4-methylcyclohexyl)benzene.
| Compound Name | 2,3-difluoro-1-[4-[(3E)-4-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-4-(4-methylcyclohexyl)benzene |
|---|---|
| PubChem CID | 143908814 |
| Molecular Formula | C27H29F3O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2,3-difluoro-1-[4-[(3E)-4-fluoro-5-methoxy-2-methylidenehexa-3,5-dienoxy]phenyl]-4-(4-methylcyclohexyl)benzene |
| SMILES | C=C(/C=C(/F)C(=C)OC)COc1ccc(-c2ccc(C3CCC(C)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C27H29F3O2/c1-17-5-7-20(8-6-17)23-13-14-24(27(30)26(23)29)21-9-11-22(12-10-21)32-16-18(2)15-25(28)19(3)31-4/h9-15,17,20H,2-3,5-8,16H2,1,4H3/b25-15+ |
| InChIKey | RISBDYZCVOTBTD-MFKUBSTISA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|