C33H23ClN4 — CID 169208282
3-(3-amino-1-tritylindazol-5-yl)-4-chlorobenzonitrile (PubChem CID 169208282) has the molecular formula C33H23ClN4 and a molecular weight of 511.03 g/mol. Its IUPAC name is 3-(3-amino-1-tritylindazol-5-yl)-4-chlorobenzonitrile.
| Compound Name | 3-(3-amino-1-tritylindazol-5-yl)-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 169208282 |
| Molecular Formula | C33H23ClN4 |
| Molecular Weight | 511.03 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | 3-(3-amino-1-tritylindazol-5-yl)-4-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Cl)c(-c2ccc3c(c2)c(N)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H23ClN4/c34-30-18-16-23(22-35)20-28(30)24-17-19-31-29(21-24)32(36)37-38(31)33(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-21H,(H2,36,37) |
| InChIKey | DZKGUUATJHFWEX-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.03 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|