C20H19ClN4O2 — CID 170249186
butyl 5-(2-chloro-5-cyanophenyl)-3-(methylamino)indazole-1-carboxylate (PubChem CID 170249186) has the molecular formula C20H19ClN4O2 and a molecular weight of 382.85 g/mol. Its IUPAC name is butyl 5-(2-chloro-5-cyanophenyl)-3-(methylamino)indazole-1-carboxylate.
| Compound Name | butyl 5-(2-chloro-5-cyanophenyl)-3-(methylamino)indazole-1-carboxylate |
|---|---|
| PubChem CID | 170249186 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | butyl 5-(2-chloro-5-cyanophenyl)-3-(methylamino)indazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(NC)c2cc(-c3cc(C#N)ccc3Cl)ccc21 |
| InChI | InChI=1S/C20H19ClN4O2/c1-3-4-9-27-20(26)25-18-8-6-14(11-16(18)19(23-2)24-25)15-10-13(12-22)5-7-17(15)21/h5-8,10-11H,3-4,9H2,1-2H3,(H,23,24) |
| InChIKey | HAGZWGBGUNIBLW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|