C29H29Cl2NO3 — CID 100962222
9-[4-(4-cyanophenyl)phenoxy]nonyl 2,5-dichlorobenzoate (PubChem CID 100962222) has the molecular formula C29H29Cl2NO3 and a molecular weight of 510.46 g/mol. Its IUPAC name is 9-[4-(4-cyanophenyl)phenoxy]nonyl 2,5-dichlorobenzoate.
| Compound Name | 9-[4-(4-cyanophenyl)phenoxy]nonyl 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 100962222 |
| Molecular Formula | C29H29Cl2NO3 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 9-[4-(4-cyanophenyl)phenoxy]nonyl 2,5-dichlorobenzoate |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCCCCOC(=O)c3cc(Cl)ccc3Cl)cc2)cc1 |
| InChI | InChI=1S/C29H29Cl2NO3/c30-25-14-17-28(31)27(20-25)29(33)35-19-7-5-3-1-2-4-6-18-34-26-15-12-24(13-16-26)23-10-8-22(21-32)9-11-23/h8-17,20H,1-7,18-19H2 |
| InChIKey | OFFHWDNNJCCVHJ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|