C54H54N4O6 — CID 102383847
7-[4-(4-cyanophenyl)phenoxy]heptyl 5-amino-2-[4-amino-2-[7-[4-(4-cyanophenyl)phenoxy]heptoxycarbonyl]phenyl]benzoate (PubChem CID 102383847) has the molecular formula C54H54N4O6 and a molecular weight of 855.05 g/mol. Its IUPAC name is 7-[4-(4-cyanophenyl)phenoxy]heptyl 5-amino-2-[4-amino-2-[7-[4-(4-cyanophenyl)phenoxy]heptoxycarbonyl]phenyl]benzoate.
| Compound Name | 7-[4-(4-cyanophenyl)phenoxy]heptyl 5-amino-2-[4-amino-2-[7-[4-(4-cyanophenyl)phenoxy]heptoxycarbonyl]phenyl]benzoate |
|---|---|
| PubChem CID | 102383847 |
| Molecular Formula | C54H54N4O6 |
| Molecular Weight | 855.05 g/mol |
| Exact Mass | 854.40 |
| IUPAC Name | 7-[4-(4-cyanophenyl)phenoxy]heptyl 5-amino-2-[4-amino-2-[7-[4-(4-cyanophenyl)phenoxy]heptoxycarbonyl]phenyl]benzoate |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCCOC(=O)c3cc(N)ccc3-c3ccc(N)cc3C(=O)OCCCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H54N4O6/c55-37-39-11-15-41(16-12-39)43-19-25-47(26-20-43)61-31-7-3-1-5-9-33-63-53(59)51-35-45(57)23-29-49(51)50-30-24-46(58)36-52(50)54(60)64-34-10-6-2-4-8-32-62-48-27-21-44(22-28-48)42-17-13-40(38-56)14-18-42/h11-30,35-36H,1-10,31-34,57-58H2 |
| InChIKey | CSSRTLAFMPIIMY-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.05 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|