C27H30ClN5O3 — CID 169207929
hexyl 5-(2-chloro-5-cyanophenyl)-3-(piperidine-3-carbonylamino)indazole-1-carboxylate (PubChem CID 169207929) has the molecular formula C27H30ClN5O3 and a molecular weight of 508.02 g/mol. Its IUPAC name is hexyl 5-(2-chloro-5-cyanophenyl)-3-(piperidine-3-carbonylamino)indazole-1-carboxylate.
| Compound Name | hexyl 5-(2-chloro-5-cyanophenyl)-3-(piperidine-3-carbonylamino)indazole-1-carboxylate |
|---|---|
| PubChem CID | 169207929 |
| Molecular Formula | C27H30ClN5O3 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | hexyl 5-(2-chloro-5-cyanophenyl)-3-(piperidine-3-carbonylamino)indazole-1-carboxylate |
| SMILES | CCCCCCOC(=O)n1nc(NC(=O)C2CCCNC2)c2cc(-c3cc(C#N)ccc3Cl)ccc21 |
| InChI | InChI=1S/C27H30ClN5O3/c1-2-3-4-5-13-36-27(35)33-24-11-9-19(21-14-18(16-29)8-10-23(21)28)15-22(24)25(32-33)31-26(34)20-7-6-12-30-17-20/h8-11,14-15,20,30H,2-7,12-13,17H2,1H3,(H,31,32,34) |
| InChIKey | PMMGCEJCOXTIQL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|