C15H14Cl2N2O3 — CID 12881652
butyl 3-(3,4-dichlorophenyl)-6-oxopyridazine-1-carboxylate (PubChem CID 12881652) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is butyl 3-(3,4-dichlorophenyl)-6-oxopyridazine-1-carboxylate.
| Compound Name | butyl 3-(3,4-dichlorophenyl)-6-oxopyridazine-1-carboxylate |
|---|---|
| PubChem CID | 12881652 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | butyl 3-(3,4-dichlorophenyl)-6-oxopyridazine-1-carboxylate |
| SMILES | CCCCOC(=O)n1nc(-c2ccc(Cl)c(Cl)c2)ccc1=O |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-2-3-8-22-15(21)19-14(20)7-6-13(18-19)10-4-5-11(16)12(17)9-10/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | LVRBTMMQFUFJLW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|