C19H14Cl2N2O3 — CID 12881642
benzyl 3-(3,5-dichloro-4-methylphenyl)-6-oxopyridazine-1-carboxylate (PubChem CID 12881642) has the molecular formula C19H14Cl2N2O3 and a molecular weight of 389.24 g/mol. Its IUPAC name is benzyl 3-(3,5-dichloro-4-methylphenyl)-6-oxopyridazine-1-carboxylate.
| Compound Name | benzyl 3-(3,5-dichloro-4-methylphenyl)-6-oxopyridazine-1-carboxylate |
|---|---|
| PubChem CID | 12881642 |
| Molecular Formula | C19H14Cl2N2O3 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | benzyl 3-(3,5-dichloro-4-methylphenyl)-6-oxopyridazine-1-carboxylate |
| SMILES | Cc1c(Cl)cc(-c2ccc(=O)n(C(=O)OCc3ccccc3)n2)cc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O3/c1-12-15(20)9-14(10-16(12)21)17-7-8-18(24)23(22-17)19(25)26-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | HFYRNGCBWSQUCQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |