C43H43BrN6O2 — CID 134472187
N-(6-bromo-1-tritylindazol-3-yl)-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide (PubChem CID 134472187) has the molecular formula C43H43BrN6O2 and a molecular weight of 755.76 g/mol. Its IUPAC name is N-(6-bromo-1-tritylindazol-3-yl)-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide.
| Compound Name | N-(6-bromo-1-tritylindazol-3-yl)-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
|---|---|
| PubChem CID | 134472187 |
| Molecular Formula | C43H43BrN6O2 |
| Molecular Weight | 755.76 g/mol |
| Exact Mass | 754.26 |
| IUPAC Name | N-(6-bromo-1-tritylindazol-3-yl)-4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3nn(C(c4ccccc4)(c4ccccc4)c4ccccc4)c4cc(Br)ccc34)c(NC3CCOCC3)c2)CC1 |
| InChI | InChI=1S/C43H43BrN6O2/c1-48-23-25-49(26-24-48)36-18-20-37(39(30-36)45-35-21-27-52-28-22-35)42(51)46-41-38-19-17-34(44)29-40(38)50(47-41)43(31-11-5-2-6-12-31,32-13-7-3-8-14-32)33-15-9-4-10-16-33/h2-20,29-30,35,45H,21-28H2,1H3,(H,46,47,51) |
| InChIKey | NTKMKCZGKOTTEQ-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.76 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|