C34H38F2N6O7S — CID 67030892
2-methoxyethyl 5-(3,5-difluorophenyl)sulfonyl-3-[[4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzoyl]amino]indazole-1-carboxylate (PubChem CID 67030892) has the molecular formula C34H38F2N6O7S and a molecular weight of 712.78 g/mol. Its IUPAC name is 2-methoxyethyl 5-(3,5-difluorophenyl)sulfonyl-3-[[4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzoyl]amino]indazole-1-carboxylate.
| Compound Name | 2-methoxyethyl 5-(3,5-difluorophenyl)sulfonyl-3-[[4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzoyl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 67030892 |
| Molecular Formula | C34H38F2N6O7S |
| Molecular Weight | 712.78 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | 2-methoxyethyl 5-(3,5-difluorophenyl)sulfonyl-3-[[4-(4-methylpiperazin-1-yl)-2-(oxan-4-ylamino)benzoyl]amino]indazole-1-carboxylate |
| SMILES | COCCOC(=O)n1nc(NC(=O)c2ccc(N3CCN(C)CC3)cc2NC2CCOCC2)c2cc(S(=O)(=O)c3cc(F)cc(F)c3)ccc21 |
| InChI | InChI=1S/C34H38F2N6O7S/c1-40-9-11-41(12-10-40)25-3-5-28(30(20-25)37-24-7-13-48-14-8-24)33(43)38-32-29-21-26(50(45,46)27-18-22(35)17-23(36)19-27)4-6-31(29)42(39-32)34(44)49-16-15-47-2/h3-6,17-21,24,37H,7-16H2,1-2H3,(H,38,39,43) |
| InChIKey | MRODBMISPZTDOY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 144.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.78 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|