C44H38F2N6O5S — CID 66736564
N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]-2-nitrobenzamide (PubChem CID 66736564) has the molecular formula C44H38F2N6O5S and a molecular weight of 800.89 g/mol. Its IUPAC name is N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]-2-nitrobenzamide.
| Compound Name | N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]-2-nitrobenzamide |
|---|---|
| PubChem CID | 66736564 |
| Molecular Formula | C44H38F2N6O5S |
| Molecular Weight | 800.89 g/mol |
| Exact Mass | 800.26 |
| IUPAC Name | N-[5-(3,5-difluorophenyl)sulfonyl-1-tritylindazol-3-yl]-4-[2-(dimethylamino)ethyl-methylamino]-2-nitrobenzamide |
| SMILES | CN(C)CCN(C)c1ccc(C(=O)Nc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccc(S(=O)(=O)c4cc(F)cc(F)c4)cc23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C44H38F2N6O5S/c1-49(2)23-24-50(3)35-19-21-38(41(28-35)52(54)55)43(53)47-42-39-29-36(58(56,57)37-26-33(45)25-34(46)27-37)20-22-40(39)51(48-42)44(30-13-7-4-8-14-30,31-15-9-5-10-16-31)32-17-11-6-12-18-32/h4-22,25-29H,23-24H2,1-3H3,(H,47,48,53) |
| InChIKey | YNDGNHAAASNEFB-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.89 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|