C28H33FN6O4S — CID 172794277
4-[2-(dimethylamino)ethyl-methylamino]-N-[5-(3-fluorophenyl)sulfonylindazol-1-yl]-2-(2-methoxyethylamino)benzamide (PubChem CID 172794277) has the molecular formula C28H33FN6O4S and a molecular weight of 568.68 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-methylamino]-N-[5-(3-fluorophenyl)sulfonylindazol-1-yl]-2-(2-methoxyethylamino)benzamide.
| Compound Name | 4-[2-(dimethylamino)ethyl-methylamino]-N-[5-(3-fluorophenyl)sulfonylindazol-1-yl]-2-(2-methoxyethylamino)benzamide |
|---|---|
| PubChem CID | 172794277 |
| Molecular Formula | C28H33FN6O4S |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.23 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl-methylamino]-N-[5-(3-fluorophenyl)sulfonylindazol-1-yl]-2-(2-methoxyethylamino)benzamide |
| SMILES | COCCNc1cc(N(C)CCN(C)C)ccc1C(=O)Nn1ncc2cc(S(=O)(=O)c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C28H33FN6O4S/c1-33(2)13-14-34(3)22-8-10-25(26(18-22)30-12-15-39-4)28(36)32-35-27-11-9-24(16-20(27)19-31-35)40(37,38)23-7-5-6-21(29)17-23/h5-11,16-19,30H,12-15H2,1-4H3,(H,32,36) |
| InChIKey | PZGXJTSVKOKSAN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|