About 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide
3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide (PubChem CID 172806374) has the molecular formula C19H13F2N5O3S
and a molecular weight of 429.41 g/mol. Its IUPAC name is 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide |
| PubChem CID | 172806374 |
| Molecular Formula | C19H13F2N5O3S |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide |
| SMILES | Nc1cnccc1C(=O)Nn1ncc2cc(S(=O)(=O)c3cc(F)cc(F)c3)ccc21 |
| InChI | InChI=1S/C19H13F2N5O3S/c20-12-6-13(21)8-15(7-12)30(28,29)14-1-2-18-11(5-14)9-24-26(18)25-19(27)16-3-4-23-10-17(16)22/h1-10H,22H2,(H,25,27) |
| InChIKey | ROKPUAKRDBKBCD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide?
The IUPAC name of 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide (CID 172806374) is 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide.
What is the SMILES notation for 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide?
The canonical SMILES for 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide is Nc1cnccc1C(=O)Nn1ncc2cc(S(=O)(=O)c3cc(F)cc(F)c3)ccc21.
What is the InChIKey of 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide?
The InChIKey is ROKPUAKRDBKBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F2N5O3S/c20-12-6-13(21)8-15(7-12)30(28,29)14-1-2-18-11(5-14)9-24-26(18)25-19(27)16-3-4-23-10-17(16)22/h1-10H,22H2,(H,25,27).
What are the key properties of 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide?
3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide has a molecular weight of 429.41 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]pyridine-4-carboxamide is sourced from PubChem (CID 172806374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).