C28H30F2N6O3S — CID 172710331
2-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]-3-[methyl(2-piperidin-1-ylethyl)amino]benzamide (PubChem CID 172710331) has the molecular formula C28H30F2N6O3S and a molecular weight of 568.65 g/mol. Its IUPAC name is 2-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]-3-[methyl(2-piperidin-1-ylethyl)amino]benzamide.
| Compound Name | 2-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]-3-[methyl(2-piperidin-1-ylethyl)amino]benzamide |
|---|---|
| PubChem CID | 172710331 |
| Molecular Formula | C28H30F2N6O3S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-amino-N-[5-(3,5-difluorophenyl)sulfonylindazol-1-yl]-3-[methyl(2-piperidin-1-ylethyl)amino]benzamide |
| SMILES | CN(CCN1CCCCC1)c1cccc(C(=O)Nn2ncc3cc(S(=O)(=O)c4cc(F)cc(F)c4)ccc32)c1N |
| InChI | InChI=1S/C28H30F2N6O3S/c1-34(12-13-35-10-3-2-4-11-35)26-7-5-6-24(27(26)31)28(37)33-36-25-9-8-22(14-19(25)18-32-36)40(38,39)23-16-20(29)15-21(30)17-23/h5-9,14-18H,2-4,10-13,31H2,1H3,(H,33,37) |
| InChIKey | FDVNWVVZUYNAQW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|