C28H29ClF2N6O5S — CID 66736476
N-[5-(3,5-difluorophenyl)sulfonyl-1H-indazol-3-yl]-4-[methyl(2-piperidin-1-ylethyl)amino]-2-nitrobenzamide;hydrochloride (PubChem CID 66736476) has the molecular formula C28H29ClF2N6O5S and a molecular weight of 635.09 g/mol. Its IUPAC name is N-[5-(3,5-difluorophenyl)sulfonyl-1H-indazol-3-yl]-4-[methyl(2-piperidin-1-ylethyl)amino]-2-nitrobenzamide;hydrochloride.
| Compound Name | N-[5-(3,5-difluorophenyl)sulfonyl-1H-indazol-3-yl]-4-[methyl(2-piperidin-1-ylethyl)amino]-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 66736476 |
| Molecular Formula | C28H29ClF2N6O5S |
| Molecular Weight | 635.09 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | N-[5-(3,5-difluorophenyl)sulfonyl-1H-indazol-3-yl]-4-[methyl(2-piperidin-1-ylethyl)amino]-2-nitrobenzamide;hydrochloride |
| SMILES | CN(CCN1CCCCC1)c1ccc(C(=O)Nc2n[nH]c3ccc(S(=O)(=O)c4cc(F)cc(F)c4)cc23)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C28H28F2N6O5S.ClH/c1-34(11-12-35-9-3-2-4-10-35)20-5-7-23(26(16-20)36(38)39)28(37)31-27-24-17-21(6-8-25(24)32-33-27)42(40,41)22-14-18(29)13-19(30)15-22;/h5-8,13-17H,2-4,9-12H2,1H3,(H2,31,32,33,37);1H |
| InChIKey | FIVJMXOEKSBVSR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.09 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|