C25H23FN6O5S — CID 66737660
N-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-nitrobenzamide (PubChem CID 66737660) has the molecular formula C25H23FN6O5S and a molecular weight of 538.56 g/mol. Its IUPAC name is N-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-nitrobenzamide.
| Compound Name | N-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 66737660 |
| Molecular Formula | C25H23FN6O5S |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | N-[5-(3-fluorophenyl)sulfonyl-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)-2-nitrobenzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4ccc(S(=O)(=O)c5cccc(F)c5)cc34)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C25H23FN6O5S/c1-30-9-11-31(12-10-30)17-5-7-20(23(14-17)32(34)35)25(33)27-24-21-15-19(6-8-22(21)28-29-24)38(36,37)18-4-2-3-16(26)13-18/h2-8,13-15H,9-12H2,1H3,(H2,27,28,29,33) |
| InChIKey | YYSQGJNUONDYQZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|