C29H32F2N6O — CID 25174242
N-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-2-(3-fluoropropylamino)-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 25174242) has the molecular formula C29H32F2N6O and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-2-(3-fluoropropylamino)-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-2-(3-fluoropropylamino)-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 25174242 |
| Molecular Formula | C29H32F2N6O |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | N-[5-[(3-fluorophenyl)methyl]-1H-indazol-3-yl]-2-(3-fluoropropylamino)-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4ccc(Cc5cccc(F)c5)cc34)c(NCCCF)c2)CC1 |
| InChI | InChI=1S/C29H32F2N6O/c1-36-12-14-37(15-13-36)23-7-8-24(27(19-23)32-11-3-10-30)29(38)33-28-25-18-21(6-9-26(25)34-35-28)16-20-4-2-5-22(31)17-20/h2,4-9,17-19,32H,3,10-16H2,1H3,(H2,33,34,35,38) |
| InChIKey | GECUKZYJOKBCIZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|