C34H44F2N6O2Si — CID 68671892
2-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 68671892) has the molecular formula C34H44F2N6O2Si and a molecular weight of 634.85 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 68671892 |
| Molecular Formula | C34H44F2N6O2Si |
| Molecular Weight | 634.85 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3n[nH]c4ccc(Cc5cc(F)cc(F)c5)cc34)c(NCCO[Si](C)(C)C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C34H44F2N6O2Si/c1-34(2,3)45(5,6)44-16-11-37-31-22-27(42-14-12-41(4)13-15-42)8-9-28(31)33(43)38-32-29-20-23(7-10-30(29)39-40-32)17-24-18-25(35)21-26(36)19-24/h7-10,18-22,37H,11-17H2,1-6H3,(H2,38,39,40,43) |
| InChIKey | BYCDSMLYDWRLDZ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.85 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|