C27H25F2N5O3 — CID 68672122
N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-2-nitro-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 68672122) has the molecular formula C27H25F2N5O3 and a molecular weight of 505.53 g/mol. Its IUPAC name is N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-2-nitro-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-2-nitro-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 68672122 |
| Molecular Formula | C27H25F2N5O3 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | N-[5-[(3,5-difluorophenyl)methyl]-1H-indazol-3-yl]-2-nitro-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | O=C(Nc1n[nH]c2ccc(Cc3cc(F)cc(F)c3)cc12)c1ccc(CN2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H25F2N5O3/c28-20-11-19(12-21(29)15-20)10-17-5-7-24-23(13-17)26(32-31-24)30-27(35)22-6-4-18(14-25(22)34(36)37)16-33-8-2-1-3-9-33/h4-7,11-15H,1-3,8-10,16H2,(H2,30,31,32,35) |
| InChIKey | RBAZPORIUOZSNO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|