C26H26F2N6O — CID 172791698
2-amino-N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-3-(4-methylpiperazin-1-yl)benzamide (PubChem CID 172791698) has the molecular formula C26H26F2N6O and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-amino-N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-3-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | 2-amino-N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-3-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 172791698 |
| Molecular Formula | C26H26F2N6O |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-amino-N-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-3-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2cccc(C(=O)Nn3ncc4cc(Cc5cc(F)cc(F)c5)ccc43)c2N)CC1 |
| InChI | InChI=1S/C26H26F2N6O/c1-32-7-9-33(10-8-32)24-4-2-3-22(25(24)29)26(35)31-34-23-6-5-17(12-19(23)16-30-34)11-18-13-20(27)15-21(28)14-18/h2-6,12-16H,7-11,29H2,1H3,(H,31,35) |
| InChIKey | PQPNFQCBPYFTBC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|