C31H34F2N6O2 — CID 172837148
N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[2-(4-methylpiperazin-1-yl)oxan-2-yl]benzohydrazide (PubChem CID 172837148) has the molecular formula C31H34F2N6O2 and a molecular weight of 560.65 g/mol. Its IUPAC name is N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[2-(4-methylpiperazin-1-yl)oxan-2-yl]benzohydrazide.
| Compound Name | N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[2-(4-methylpiperazin-1-yl)oxan-2-yl]benzohydrazide |
|---|---|
| PubChem CID | 172837148 |
| Molecular Formula | C31H34F2N6O2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[2-(4-methylpiperazin-1-yl)oxan-2-yl]benzohydrazide |
| SMILES | CN1CCN(C2(N(NC(=O)c3ccccc3)n3ncc4cc(Cc5cc(F)cc(F)c5)ccc43)CCCCO2)CC1 |
| InChI | InChI=1S/C31H34F2N6O2/c1-36-12-14-37(15-13-36)31(11-5-6-16-41-31)39(35-30(40)25-7-3-2-4-8-25)38-29-10-9-23(18-26(29)22-34-38)17-24-19-27(32)21-28(33)20-24/h2-4,7-10,18-22H,5-6,11-17H2,1H3,(H,35,40) |
| InChIKey | WHMJVBSGKDEMLQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|