C30H34F2N6O2 — CID 172788545
N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[(2R)-1-methoxypropan-2-yl]-2-(4-methylpiperazin-1-yl)benzohydrazide (PubChem CID 172788545) has the molecular formula C30H34F2N6O2 and a molecular weight of 548.64 g/mol. Its IUPAC name is N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[(2R)-1-methoxypropan-2-yl]-2-(4-methylpiperazin-1-yl)benzohydrazide.
| Compound Name | N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[(2R)-1-methoxypropan-2-yl]-2-(4-methylpiperazin-1-yl)benzohydrazide |
|---|---|
| PubChem CID | 172788545 |
| Molecular Formula | C30H34F2N6O2 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | N'-[5-[(3,5-difluorophenyl)methyl]indazol-1-yl]-N'-[(2R)-1-methoxypropan-2-yl]-2-(4-methylpiperazin-1-yl)benzohydrazide |
| SMILES | COC[C@@H](C)N(NC(=O)c1ccccc1N1CCN(C)CC1)n1ncc2cc(Cc3cc(F)cc(F)c3)ccc21 |
| InChI | InChI=1S/C30H34F2N6O2/c1-21(20-40-3)37(34-30(39)27-6-4-5-7-29(27)36-12-10-35(2)11-13-36)38-28-9-8-22(15-24(28)19-33-38)14-23-16-25(31)18-26(32)17-23/h4-9,15-19,21H,10-14,20H2,1-3H3,(H,34,39)/t21-/m1/s1 |
| InChIKey | PFYREFGNNMYPFA-OAQYLSRUSA-N |
| XLogP | 3.97 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|