C28H33F2N6O2+ — CID 163956291
[[2-amino-5-[(3,5-difluorophenyl)methyl]phenyl]-[[2-(2-hydroxyethylamino)-4-(4-methylpiperazin-1-yl)benzoyl]amino]methylidene]azanium (PubChem CID 163956291) has the molecular formula C28H33F2N6O2+ and a molecular weight of 523.61 g/mol. Its IUPAC name is [[2-amino-5-[(3,5-difluorophenyl)methyl]phenyl]-[[2-(2-hydroxyethylamino)-4-(4-methylpiperazin-1-yl)benzoyl]amino]methylidene]azanium.
| Compound Name | [[2-amino-5-[(3,5-difluorophenyl)methyl]phenyl]-[[2-(2-hydroxyethylamino)-4-(4-methylpiperazin-1-yl)benzoyl]amino]methylidene]azanium |
|---|---|
| PubChem CID | 163956291 |
| Molecular Formula | C28H33F2N6O2+ |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | [[2-amino-5-[(3,5-difluorophenyl)methyl]phenyl]-[[2-(2-hydroxyethylamino)-4-(4-methylpiperazin-1-yl)benzoyl]amino]methylidene]azanium |
| SMILES | CN1CCN(c2ccc(C(=O)NC(=[NH2+])c3cc(Cc4cc(F)cc(F)c4)ccc3N)c(NCCO)c2)CC1 |
| InChI | InChI=1S/C28H32F2N6O2/c1-35-7-9-36(10-8-35)22-3-4-23(26(17-22)33-6-11-37)28(38)34-27(32)24-15-18(2-5-25(24)31)12-19-13-20(29)16-21(30)14-19/h2-5,13-17,33,37H,6-12,31H2,1H3,(H2,32,34,38)/p+1 |
| InChIKey | SDQWCJJIGBZKSQ-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|