C14H19ClFN3O — CID 139271240
2-(2-fluoroethylamino)-4-(4-methylpiperazin-1-yl)benzoyl chloride (PubChem CID 139271240) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 2-(2-fluoroethylamino)-4-(4-methylpiperazin-1-yl)benzoyl chloride.
| Compound Name | 2-(2-fluoroethylamino)-4-(4-methylpiperazin-1-yl)benzoyl chloride |
|---|---|
| PubChem CID | 139271240 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(2-fluoroethylamino)-4-(4-methylpiperazin-1-yl)benzoyl chloride |
| SMILES | CN1CCN(c2ccc(C(=O)Cl)c(NCCF)c2)CC1 |
| InChI | InChI=1S/C14H19ClFN3O/c1-18-6-8-19(9-7-18)11-2-3-12(14(15)20)13(10-11)17-5-4-16/h2-3,10,17H,4-9H2,1H3 |
| InChIKey | IINFSIAKNWQUIF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|