C20H25F2N3O2S — CID 18508983
2-(3,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-N-propylaniline (PubChem CID 18508983) has the molecular formula C20H25F2N3O2S and a molecular weight of 409.50 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-N-propylaniline.
| Compound Name | 2-(3,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-N-propylaniline |
|---|---|
| PubChem CID | 18508983 |
| Molecular Formula | C20H25F2N3O2S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)-N-propylaniline |
| SMILES | CCCNc1cc(N2CCN(C)CC2)ccc1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H25F2N3O2S/c1-3-8-23-19-13-15(25-11-9-24(2)10-12-25)4-7-20(19)28(26,27)16-5-6-17(21)18(22)14-16/h4-7,13-14,23H,3,8-12H2,1-2H3 |
| InChIKey | KULLHJVWQWHXEV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |