C21H28FN3O2S — CID 18508938
2-(3-fluorophenyl)sulfonyl-5-(4-methyl-1,4-diazepan-1-yl)-N-propylaniline (PubChem CID 18508938) has the molecular formula C21H28FN3O2S and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-(3-fluorophenyl)sulfonyl-5-(4-methyl-1,4-diazepan-1-yl)-N-propylaniline.
| Compound Name | 2-(3-fluorophenyl)sulfonyl-5-(4-methyl-1,4-diazepan-1-yl)-N-propylaniline |
|---|---|
| PubChem CID | 18508938 |
| Molecular Formula | C21H28FN3O2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-(3-fluorophenyl)sulfonyl-5-(4-methyl-1,4-diazepan-1-yl)-N-propylaniline |
| SMILES | CCCNc1cc(N2CCCN(C)CC2)ccc1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H28FN3O2S/c1-3-10-23-20-16-18(25-12-5-11-24(2)13-14-25)8-9-21(20)28(26,27)19-7-4-6-17(22)15-19/h4,6-9,15-16,23H,3,5,10-14H2,1-2H3 |
| InChIKey | SOSMLQIQXPQXBL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |