C19H25FN4O2S — CID 22272539
N-[2-(ethylamino)-4-(4-methylpiperazin-1-yl)phenyl]-3-fluorobenzenesulfonamide (PubChem CID 22272539) has the molecular formula C19H25FN4O2S and a molecular weight of 392.50 g/mol. Its IUPAC name is N-[2-(ethylamino)-4-(4-methylpiperazin-1-yl)phenyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[2-(ethylamino)-4-(4-methylpiperazin-1-yl)phenyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22272539 |
| Molecular Formula | C19H25FN4O2S |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[2-(ethylamino)-4-(4-methylpiperazin-1-yl)phenyl]-3-fluorobenzenesulfonamide |
| SMILES | CCNc1cc(N2CCN(C)CC2)ccc1NS(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN4O2S/c1-3-21-19-14-16(24-11-9-23(2)10-12-24)7-8-18(19)22-27(25,26)17-6-4-5-15(20)13-17/h4-8,13-14,21-22H,3,9-12H2,1-2H3 |
| InChIKey | PAKQKYBVAACSLL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |