C18H21F2N3O3S — CID 56654456
N-[2-(difluoromethoxy)phenyl]-3-(4-methylpiperazin-1-yl)benzenesulfonamide (PubChem CID 56654456) has the molecular formula C18H21F2N3O3S and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-3-(4-methylpiperazin-1-yl)benzenesulfonamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-3-(4-methylpiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 56654456 |
| Molecular Formula | C18H21F2N3O3S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-3-(4-methylpiperazin-1-yl)benzenesulfonamide |
| SMILES | CN1CCN(c2cccc(S(=O)(=O)Nc3ccccc3OC(F)F)c2)CC1 |
| InChI | InChI=1S/C18H21F2N3O3S/c1-22-9-11-23(12-10-22)14-5-4-6-15(13-14)27(24,25)21-16-7-2-3-8-17(16)26-18(19)20/h2-8,13,18,21H,9-12H2,1H3 |
| InChIKey | BWSAQXKIGOJAHO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |