C17H19F2N3O3S — CID 56654455
N-[2-(difluoromethoxy)phenyl]-3-piperazin-1-ylbenzenesulfonamide (PubChem CID 56654455) has the molecular formula C17H19F2N3O3S and a molecular weight of 383.42 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-3-piperazin-1-ylbenzenesulfonamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-3-piperazin-1-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 56654455 |
| Molecular Formula | C17H19F2N3O3S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-3-piperazin-1-ylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1OC(F)F)c1cccc(N2CCNCC2)c1 |
| InChI | InChI=1S/C17H19F2N3O3S/c18-17(19)25-16-7-2-1-6-15(16)21-26(23,24)14-5-3-4-13(12-14)22-10-8-20-9-11-22/h1-7,12,17,20-21H,8-11H2 |
| InChIKey | AWFXQTKMNCEJAB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |