C22H24ClFN4O4S2 — CID 174449060
N-[2-[benzenesulfonyl(fluoro)amino]-5-piperazin-1-ylphenyl]benzenesulfonamide;hydrochloride (PubChem CID 174449060) has the molecular formula C22H24ClFN4O4S2 and a molecular weight of 527.04 g/mol. Its IUPAC name is N-[2-[benzenesulfonyl(fluoro)amino]-5-piperazin-1-ylphenyl]benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-[benzenesulfonyl(fluoro)amino]-5-piperazin-1-ylphenyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 174449060 |
| Molecular Formula | C22H24ClFN4O4S2 |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | N-[2-[benzenesulfonyl(fluoro)amino]-5-piperazin-1-ylphenyl]benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(Nc1cc(N2CCNCC2)ccc1N(F)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23FN4O4S2.ClH/c23-27(33(30,31)20-9-5-2-6-10-20)22-12-11-18(26-15-13-24-14-16-26)17-21(22)25-32(28,29)19-7-3-1-4-8-19;/h1-12,17,24-25H,13-16H2;1H |
| InChIKey | MOOBLNSJKJBUOU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|