C26H33ClN4O5S2 — CID 22272453
N-[2-(benzenesulfonamido)-4-piperazin-1-ylphenyl]-4-butoxybenzenesulfonamide;hydrochloride (PubChem CID 22272453) has the molecular formula C26H33ClN4O5S2 and a molecular weight of 581.16 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)-4-piperazin-1-ylphenyl]-4-butoxybenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(benzenesulfonamido)-4-piperazin-1-ylphenyl]-4-butoxybenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 22272453 |
| Molecular Formula | C26H33ClN4O5S2 |
| Molecular Weight | 581.16 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | N-[2-(benzenesulfonamido)-4-piperazin-1-ylphenyl]-4-butoxybenzenesulfonamide;hydrochloride |
| SMILES | CCCCOc1ccc(S(=O)(=O)Nc2ccc(N3CCNCC3)cc2NS(=O)(=O)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C26H32N4O5S2.ClH/c1-2-3-19-35-22-10-12-24(13-11-22)37(33,34)28-25-14-9-21(30-17-15-27-16-18-30)20-26(25)29-36(31,32)23-7-5-4-6-8-23;/h4-14,20,27-29H,2-3,15-19H2,1H3;1H |
| InChIKey | NZBFIBIZNVRWEI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.16 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|