C23H29F2N3O6S — CID 86675738
butyl 4-[5-[[2-(difluoromethoxy)phenyl]sulfamoyl]-2-methoxyphenyl]piperazine-1-carboxylate (PubChem CID 86675738) has the molecular formula C23H29F2N3O6S and a molecular weight of 513.56 g/mol. Its IUPAC name is butyl 4-[5-[[2-(difluoromethoxy)phenyl]sulfamoyl]-2-methoxyphenyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[5-[[2-(difluoromethoxy)phenyl]sulfamoyl]-2-methoxyphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86675738 |
| Molecular Formula | C23H29F2N3O6S |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | butyl 4-[5-[[2-(difluoromethoxy)phenyl]sulfamoyl]-2-methoxyphenyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(c2cc(S(=O)(=O)Nc3ccccc3OC(F)F)ccc2OC)CC1 |
| InChI | InChI=1S/C23H29F2N3O6S/c1-3-4-15-33-23(29)28-13-11-27(12-14-28)19-16-17(9-10-21(19)32-2)35(30,31)26-18-7-5-6-8-20(18)34-22(24)25/h5-10,16,22,26H,3-4,11-15H2,1-2H3 |
| InChIKey | HMESYFVVPRBHRY-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|