C21H26FN3O3S — CID 18508984
N-ethyl-N-[2-(4-fluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)phenyl]acetamide (PubChem CID 18508984) has the molecular formula C21H26FN3O3S and a molecular weight of 419.52 g/mol. Its IUPAC name is N-ethyl-N-[2-(4-fluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | N-ethyl-N-[2-(4-fluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 18508984 |
| Molecular Formula | C21H26FN3O3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | N-ethyl-N-[2-(4-fluorophenyl)sulfonyl-5-(4-methylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN(C(C)=O)c1cc(N2CCN(C)CC2)ccc1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O3S/c1-4-25(16(2)26)20-15-18(24-13-11-23(3)12-14-24)7-10-21(20)29(27,28)19-8-5-17(22)6-9-19/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | MGQUEVAMXKPJIQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |