C17H25N3O4 — CID 134464811
2-[acetyl(2-methoxyethyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid (PubChem CID 134464811) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[acetyl(2-methoxyethyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid.
| Compound Name | 2-[acetyl(2-methoxyethyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 134464811 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[acetyl(2-methoxyethyl)amino]-4-(4-methylpiperazin-1-yl)benzoic acid |
| SMILES | COCCN(C(C)=O)c1cc(N2CCN(C)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C17H25N3O4/c1-13(21)20(10-11-24-3)16-12-14(4-5-15(16)17(22)23)19-8-6-18(2)7-9-19/h4-5,12H,6-11H2,1-3H3,(H,22,23) |
| InChIKey | JNFPJNGDVXIRCN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |