C19H23ClF3N3O3 — CID 153489978
4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)-(2,2,2-trifluoroacetyl)amino]benzoyl chloride (PubChem CID 153489978) has the molecular formula C19H23ClF3N3O3 and a molecular weight of 437.88 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)-(2,2,2-trifluoroacetyl)amino]benzoyl chloride.
| Compound Name | 4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)-(2,2,2-trifluoroacetyl)amino]benzoyl chloride |
|---|---|
| PubChem CID | 153489978 |
| Molecular Formula | C19H23ClF3N3O3 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-2-[(2,2,6,6-tetradeuteriooxan-4-yl)-(2,2,2-trifluoroacetyl)amino]benzoyl chloride |
| SMILES | [2H]C1([2H])CC(N(C(=O)C(F)(F)F)c2cc(N3CCN(C)CC3)ccc2C(=O)Cl)CC([2H])([2H])O1 |
| InChI | InChI=1S/C19H23ClF3N3O3/c1-24-6-8-25(9-7-24)14-2-3-15(17(20)27)16(12-14)26(18(28)19(21,22)23)13-4-10-29-11-5-13/h2-3,12-13H,4-11H2,1H3/i10D2,11D2 |
| InChIKey | LLELYBOBWUIICJ-MKQHWYKPSA-N |
| XLogP | 2.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|