C23H32F3N3O4 — CID 153489957
tert-butyl 4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate (PubChem CID 153489957) has the molecular formula C23H32F3N3O4 and a molecular weight of 479.57 g/mol. Its IUPAC name is tert-butyl 4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate.
| Compound Name | tert-butyl 4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate |
|---|---|
| PubChem CID | 153489957 |
| Molecular Formula | C23H32F3N3O4 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | tert-butyl 4-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)-2-[oxan-4-yl-(2,2,2-trifluoroacetyl)amino]benzoate |
| SMILES | [2H]C1([2H])N(C)C([2H])([2H])C([2H])([2H])N(c2ccc(C(=O)OC(C)(C)C)c(N(C(=O)C(F)(F)F)C3CCOCC3)c2)C1([2H])[2H] |
| InChI | InChI=1S/C23H32F3N3O4/c1-22(2,3)33-20(30)18-6-5-17(28-11-9-27(4)10-12-28)15-19(18)29(21(31)23(24,25)26)16-7-13-32-14-8-16/h5-6,15-16H,7-14H2,1-4H3/i9D2,10D2,11D2,12D2 |
| InChIKey | VIQYAFNMWMBICL-PMCMNDOISA-N |
| XLogP | 3.47 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |