C26H26N2O4 — CID 66990742
2-[(2-hydroxy-5-piperidin-1-ylbenzoyl)amino]-4-(3-methylphenyl)benzoic acid (PubChem CID 66990742) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2-[(2-hydroxy-5-piperidin-1-ylbenzoyl)amino]-4-(3-methylphenyl)benzoic acid.
| Compound Name | 2-[(2-hydroxy-5-piperidin-1-ylbenzoyl)amino]-4-(3-methylphenyl)benzoic acid |
|---|---|
| PubChem CID | 66990742 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 2-[(2-hydroxy-5-piperidin-1-ylbenzoyl)amino]-4-(3-methylphenyl)benzoic acid |
| SMILES | Cc1cccc(-c2ccc(C(=O)O)c(NC(=O)c3cc(N4CCCCC4)ccc3O)c2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-17-6-5-7-18(14-17)19-8-10-21(26(31)32)23(15-19)27-25(30)22-16-20(9-11-24(22)29)28-12-3-2-4-13-28/h5-11,14-16,29H,2-4,12-13H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | PLKGDIFMGAYHAZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |